C21H23NO5 — CID 10737815
methyl (2S)-2-cyclopropyl-2-(methoxycarbonylamino)-2-(4-phenylmethoxyphenyl)acetate (PubChem CID 10737815) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (2S)-2-cyclopropyl-2-(methoxycarbonylamino)-2-(4-phenylmethoxyphenyl)acetate.
| Compound Name | methyl (2S)-2-cyclopropyl-2-(methoxycarbonylamino)-2-(4-phenylmethoxyphenyl)acetate |
|---|---|
| PubChem CID | 10737815 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl (2S)-2-cyclopropyl-2-(methoxycarbonylamino)-2-(4-phenylmethoxyphenyl)acetate |
| SMILES | COC(=O)N[C@](C(=O)OC)(c1ccc(OCc2ccccc2)cc1)C1CC1 |
| InChI | InChI=1S/C21H23NO5/c1-25-19(23)21(16-8-9-16,22-20(24)26-2)17-10-12-18(13-11-17)27-14-15-6-4-3-5-7-15/h3-7,10-13,16H,8-9,14H2,1-2H3,(H,22,24)/t21-/m0/s1 |
| InChIKey | CADJJAPILJYXEM-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |