C22H25N3O3 — CID 129170988
methyl 2-cyano-2-cyclopentyl-2-[2-(4-phenylmethoxyphenyl)hydrazinyl]acetate (PubChem CID 129170988) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is methyl 2-cyano-2-cyclopentyl-2-[2-(4-phenylmethoxyphenyl)hydrazinyl]acetate.
| Compound Name | methyl 2-cyano-2-cyclopentyl-2-[2-(4-phenylmethoxyphenyl)hydrazinyl]acetate |
|---|---|
| PubChem CID | 129170988 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | methyl 2-cyano-2-cyclopentyl-2-[2-(4-phenylmethoxyphenyl)hydrazinyl]acetate |
| SMILES | COC(=O)C(C#N)(NNc1ccc(OCc2ccccc2)cc1)C1CCCC1 |
| InChI | InChI=1S/C22H25N3O3/c1-27-21(26)22(16-23,18-9-5-6-10-18)25-24-19-11-13-20(14-12-19)28-15-17-7-3-2-4-8-17/h2-4,7-8,11-14,18,24-25H,5-6,9-10,15H2,1H3 |
| InChIKey | GVCUAEJKYAMGCU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|