C11H16N2O3S — CID 107380163
ethyl 5-acetyl-2-(2-aminopropyl)-1,3-thiazole-4-carboxylate (PubChem CID 107380163) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is ethyl 5-acetyl-2-(2-aminopropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-acetyl-2-(2-aminopropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 107380163 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 5-acetyl-2-(2-aminopropyl)-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(CC(C)N)sc1C(C)=O |
| InChI | InChI=1S/C11H16N2O3S/c1-4-16-11(15)9-10(7(3)14)17-8(13-9)5-6(2)12/h6H,4-5,12H2,1-3H3 |
| InChIKey | KYBHZUZBLYZWCC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |