C12H15N3O2 — CID 107381360
N-[[5-(furan-2-ylmethoxy)pyrazin-2-yl]methyl]ethanamine (PubChem CID 107381360) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[[5-(furan-2-ylmethoxy)pyrazin-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-(furan-2-ylmethoxy)pyrazin-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 107381360 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[[5-(furan-2-ylmethoxy)pyrazin-2-yl]methyl]ethanamine |
| SMILES | CCNCc1cnc(OCc2ccco2)cn1 |
| InChI | InChI=1S/C12H15N3O2/c1-2-13-6-10-7-15-12(8-14-10)17-9-11-4-3-5-16-11/h3-5,7-8,13H,2,6,9H2,1H3 |
| InChIKey | INWOXUVKNZRSPX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |