C16H8ClFN4O2S — CID 10738209
2-(4-chlorophenyl)-6-(4-fluorophenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one (PubChem CID 10738209) has the molecular formula C16H8ClFN4O2S and a molecular weight of 374.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6-(4-fluorophenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one.
| Compound Name | 2-(4-chlorophenyl)-6-(4-fluorophenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 10738209 |
| Molecular Formula | C16H8ClFN4O2S |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 2-(4-chlorophenyl)-6-(4-fluorophenyl)-5-sulfanylidene-[1,3,4]oxadiazolo[3,2-a][1,3,5]triazin-7-one |
| SMILES | O=c1nc2oc(-c3ccc(Cl)cc3)nn2c(=S)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C16H8ClFN4O2S/c17-10-3-1-9(2-4-10)13-20-22-15(24-13)19-14(23)21(16(22)25)12-7-5-11(18)6-8-12/h1-8H |
| InChIKey | UXPSZEMMLONJSA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|