C14H14F2O — CID 107382899
3-[(2,4-difluorophenyl)methyl]cyclohept-2-en-1-one (PubChem CID 107382899) has the molecular formula C14H14F2O and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]cyclohept-2-en-1-one.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]cyclohept-2-en-1-one |
|---|---|
| PubChem CID | 107382899 |
| Molecular Formula | C14H14F2O |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]cyclohept-2-en-1-one |
| SMILES | O=C1C=C(Cc2ccc(F)cc2F)CCCC1 |
| InChI | InChI=1S/C14H14F2O/c15-12-6-5-11(14(16)9-12)7-10-3-1-2-4-13(17)8-10/h5-6,8-9H,1-4,7H2 |
| InChIKey | QIMPHPXURLYFBM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |