C16H22N2O3 — CID 107389176
N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1,2,3,4-tetrahydroquinoline-6-carboxamide (PubChem CID 107389176) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1,2,3,4-tetrahydroquinoline-6-carboxamide.
| Compound Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1,2,3,4-tetrahydroquinoline-6-carboxamide |
|---|---|
| PubChem CID | 107389176 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1,2,3,4-tetrahydroquinoline-6-carboxamide |
| SMILES | CC1(C)OCC(CNC(=O)c2ccc3c(c2)CCCN3)O1 |
| InChI | InChI=1S/C16H22N2O3/c1-16(2)20-10-13(21-16)9-18-15(19)12-5-6-14-11(8-12)4-3-7-17-14/h5-6,8,13,17H,3-4,7,9-10H2,1-2H3,(H,18,19) |
| InChIKey | VGOPXESRPYNOGC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |