C21H42O4Si2 — CID 10740547
tert-butyl-[[(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane (PubChem CID 10740547) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 10740547 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | tert-butyl-[[(2R,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-yl]oxy]-dimethylsilane |
| SMILES | C=CCO[C@@H]1C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C21H42O4Si2/c1-12-15-22-19-14-13-17(25-27(10,11)21(5,6)7)18(24-19)16-23-26(8,9)20(2,3)4/h12-14,17-19H,1,15-16H2,2-11H3/t17-,18+,19-/m0/s1 |
| InChIKey | NIUFDRHJLFMWPY-OTWHNJEPSA-N |
| XLogP | 5.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|