C26H25NO4 — CID 10740574
methyl 2-[(S)-[(3S)-3-hydroxy-1-[(1R)-1-naphthalen-1-ylethyl]-2-oxoazetidin-3-yl]-phenylmethyl]prop-2-enoate (PubChem CID 10740574) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is methyl 2-[(S)-[(3S)-3-hydroxy-1-[(1R)-1-naphthalen-1-ylethyl]-2-oxoazetidin-3-yl]-phenylmethyl]prop-2-enoate.
| Compound Name | methyl 2-[(S)-[(3S)-3-hydroxy-1-[(1R)-1-naphthalen-1-ylethyl]-2-oxoazetidin-3-yl]-phenylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 10740574 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | methyl 2-[(S)-[(3S)-3-hydroxy-1-[(1R)-1-naphthalen-1-ylethyl]-2-oxoazetidin-3-yl]-phenylmethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H](c1ccccc1)[C@]1(O)CN([C@H](C)c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C26H25NO4/c1-17(24(28)31-3)23(20-11-5-4-6-12-20)26(30)16-27(25(26)29)18(2)21-15-9-13-19-10-7-8-14-22(19)21/h4-15,18,23,30H,1,16H2,2-3H3/t18-,23-,26-/m1/s1 |
| InChIKey | AKXKGUBLYQMEIA-XZLZDHACSA-N |
| XLogP | 3.99 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|