C16H26N2O2S — CID 107407046
3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline (PubChem CID 107407046) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline.
| Compound Name | 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline |
|---|---|
| PubChem CID | 107407046 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)N2CC(C)CC2C)c1 |
| InChI | InChI=1S/C16H26N2O2S/c1-5-13-8-15(17)14(6-2)16(9-13)21(19,20)18-10-11(3)7-12(18)4/h8-9,11-12H,5-7,10,17H2,1-4H3 |
| InChIKey | ZIWYKWLIJVEZTD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|