About 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline
3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline (PubChem CID 107407046) has the molecular formula C16H26N2O2S
and a molecular weight of 310.46 g/mol. Its IUPAC name is 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline.
Molecular Properties
| Compound Name | 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline |
| PubChem CID | 107407046 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline |
| SMILES | CCc1cc(N)c(CC)c(S(=O)(=O)N2CC(C)CC2C)c1 |
| InChI | InChI=1S/C16H26N2O2S/c1-5-13-8-15(17)14(6-2)16(9-13)21(19,20)18-10-11(3)7-12(18)4/h8-9,11-12H,5-7,10,17H2,1-4H3 |
| InChIKey | ZIWYKWLIJVEZTD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline?
The IUPAC name of 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline (CID 107407046) is 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline.
What is the SMILES notation for 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline?
The canonical SMILES for 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline is CCc1cc(N)c(CC)c(S(=O)(=O)N2CC(C)CC2C)c1.
What is the InChIKey of 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline?
The InChIKey is ZIWYKWLIJVEZTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2S/c1-5-13-8-15(17)14(6-2)16(9-13)21(19,20)18-10-11(3)7-12(18)4/h8-9,11-12H,5-7,10,17H2,1-4H3.
What are the key properties of 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline?
3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline has a molecular weight of 310.46 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylpyrrolidin-1-yl)sulfonyl-2,5-diethylaniline is sourced from PubChem (CID 107407046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).