C16H25N3O — CID 107411309
4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide (PubChem CID 107411309) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide |
|---|---|
| PubChem CID | 107411309 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide |
| SMILES | CC1CCC(CNc2cc(C(=O)N(C)C)ccc2N)C1 |
| InChI | InChI=1S/C16H25N3O/c1-11-4-5-12(8-11)10-18-15-9-13(6-7-14(15)17)16(20)19(2)3/h6-7,9,11-12,18H,4-5,8,10,17H2,1-3H3 |
| InChIKey | HIMZERGXLIPXJL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|