About 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide
4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide (PubChem CID 107411309) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide.
Molecular Properties
| Compound Name | 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide |
| PubChem CID | 107411309 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide |
| SMILES | CC1CCC(CNc2cc(C(=O)N(C)C)ccc2N)C1 |
| InChI | InChI=1S/C16H25N3O/c1-11-4-5-12(8-11)10-18-15-9-13(6-7-14(15)17)16(20)19(2)3/h6-7,9,11-12,18H,4-5,8,10,17H2,1-3H3 |
| InChIKey | HIMZERGXLIPXJL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide?
The IUPAC name of 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide (CID 107411309) is 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide.
What is the SMILES notation for 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide?
The canonical SMILES for 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide is CC1CCC(CNc2cc(C(=O)N(C)C)ccc2N)C1.
What is the InChIKey of 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide?
The InChIKey is HIMZERGXLIPXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-11-4-5-12(8-11)10-18-15-9-13(6-7-14(15)17)16(20)19(2)3/h6-7,9,11-12,18H,4-5,8,10,17H2,1-3H3.
What are the key properties of 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide?
4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide has a molecular weight of 275.40 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N-dimethyl-3-[(3-methylcyclopentyl)methylamino]benzamide is sourced from PubChem (CID 107411309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).