C21H32F3NO3Si — CID 10741345
(2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2S)-2-(triethylsilyloxymethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 10741345) has the molecular formula C21H32F3NO3Si and a molecular weight of 431.57 g/mol. Its IUPAC name is (2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2S)-2-(triethylsilyloxymethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2S)-2-(triethylsilyloxymethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 10741345 |
| Molecular Formula | C21H32F3NO3Si |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[(2S)-2-(triethylsilyloxymethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CC[Si](CC)(CC)OC[C@@H]1CCCN1C(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H32F3NO3Si/c1-5-29(6-2,7-3)28-16-18-14-11-15-25(18)19(26)20(27-4,21(22,23)24)17-12-9-8-10-13-17/h8-10,12-13,18H,5-7,11,14-16H2,1-4H3/t18-,20+/m0/s1 |
| InChIKey | ODBQAXXTCNZUBW-AZUAARDMSA-N |
| XLogP | 5.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|