C15H22ClN3O — CID 107418885
3-chloro-N'-hydroxy-4-[[(2-methylcyclopentyl)methylamino]methyl]benzenecarboximidamide (PubChem CID 107418885) has the molecular formula C15H22ClN3O and a molecular weight of 295.81 g/mol. Its IUPAC name is 3-chloro-N'-hydroxy-4-[[(2-methylcyclopentyl)methylamino]methyl]benzenecarboximidamide.
| Compound Name | 3-chloro-N'-hydroxy-4-[[(2-methylcyclopentyl)methylamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 107418885 |
| Molecular Formula | C15H22ClN3O |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 3-chloro-N'-hydroxy-4-[[(2-methylcyclopentyl)methylamino]methyl]benzenecarboximidamide |
| SMILES | CC1CCCC1CNCc1ccc(/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C15H22ClN3O/c1-10-3-2-4-12(10)8-18-9-13-6-5-11(7-14(13)16)15(17)19-20/h5-7,10,12,18,20H,2-4,8-9H2,1H3,(H2,17,19) |
| InChIKey | SMCNDNWZLOSUSZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|