C21H22N2O7S — CID 10742017
(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 5-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 10742017) has the molecular formula C21H22N2O7S and a molecular weight of 446.48 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 5-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 5-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 10742017 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 5-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | O=C(CCCCNC(=O)OCc1ccccc1)OCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H22N2O7S/c24-19(12-6-7-13-22-21(26)29-14-16-8-2-1-3-9-16)30-15-23-20(25)17-10-4-5-11-18(17)31(23,27)28/h1-5,8-11H,6-7,12-15H2,(H,22,26) |
| InChIKey | YPSXMLHFZYLLMR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|