C29H34O4 — CID 10742034
(3R,7R)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-1,9-diphenylnonan-5-one (PubChem CID 10742034) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (3R,7R)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-1,9-diphenylnonan-5-one.
| Compound Name | (3R,7R)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-1,9-diphenylnonan-5-one |
|---|---|
| PubChem CID | 10742034 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (3R,7R)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-1,9-diphenylnonan-5-one |
| SMILES | COc1ccc(CO[C@H](CCc2ccccc2)CC(=O)C[C@H](O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H34O4/c1-32-28-17-14-25(15-18-28)22-33-29(19-13-24-10-6-3-7-11-24)21-27(31)20-26(30)16-12-23-8-4-2-5-9-23/h2-11,14-15,17-18,26,29-30H,12-13,16,19-22H2,1H3/t26-,29-/m1/s1 |
| InChIKey | QNTIXYROPGVWIB-GGXMVOPNSA-N |
| XLogP | 5.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |