C31H46Si — CID 10742048
[3,5-bis(3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)phenyl]-trimethylsilane (PubChem CID 10742048) has the molecular formula C31H46Si and a molecular weight of 446.80 g/mol. Its IUPAC name is [3,5-bis(3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)phenyl]-trimethylsilane.
| Compound Name | [3,5-bis(3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 10742048 |
| Molecular Formula | C31H46Si |
| Molecular Weight | 446.80 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | [3,5-bis(3-cyclohexyl-1-bicyclo[1.1.1]pentanyl)phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(C23CC(C4CCCCC4)(C2)C3)cc(C23CC(C4CCCCC4)(C2)C3)c1 |
| InChI | InChI=1S/C31H46Si/c1-32(2,3)27-15-25(30-17-28(18-30,19-30)23-10-6-4-7-11-23)14-26(16-27)31-20-29(21-31,22-31)24-12-8-5-9-13-24/h14-16,23-24H,4-13,17-22H2,1-3H3 |
| InChIKey | GWIPCOPJTXEYJJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.80 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|