C14H17N3O2 — CID 107422530
N-(3-methylpyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide (PubChem CID 107422530) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(3-methylpyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide.
| Compound Name | N-(3-methylpyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 107422530 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-(3-methylpyrrolidin-3-yl)-2-oxo-1,3-dihydroindole-5-carboxamide |
| SMILES | CC1(NC(=O)c2ccc3c(c2)CC(=O)N3)CCNC1 |
| InChI | InChI=1S/C14H17N3O2/c1-14(4-5-15-8-14)17-13(19)9-2-3-11-10(6-9)7-12(18)16-11/h2-3,6,15H,4-5,7-8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | JWKGTCHBQPIIRT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |