C14H21BrN2O3 — CID 107425881
2-[2-(3-bromophenoxy)ethyl-[2-(dimethylamino)ethyl]amino]acetic acid (PubChem CID 107425881) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-[2-(3-bromophenoxy)ethyl-[2-(dimethylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[2-(3-bromophenoxy)ethyl-[2-(dimethylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 107425881 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[2-(3-bromophenoxy)ethyl-[2-(dimethylamino)ethyl]amino]acetic acid |
| SMILES | CN(C)CCN(CCOc1cccc(Br)c1)CC(=O)O |
| InChI | InChI=1S/C14H21BrN2O3/c1-16(2)6-7-17(11-14(18)19)8-9-20-13-5-3-4-12(15)10-13/h3-5,10H,6-9,11H2,1-2H3,(H,18,19) |
| InChIKey | MHIBXCFMCBAHTF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |