C21H29F3N2O6 — CID 10742703
methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]hexanoate (PubChem CID 10742703) has the molecular formula C21H29F3N2O6 and a molecular weight of 462.47 g/mol. Its IUPAC name is methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]hexanoate.
| Compound Name | methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 10742703 |
| Molecular Formula | C21H29F3N2O6 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | methyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[[4-(trifluoromethyl)phenyl]methoxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H29F3N2O6/c1-20(2,3)32-18(28)25-12-6-5-7-16(17(27)30-4)26-19(29)31-13-14-8-10-15(11-9-14)21(22,23)24/h8-11,16H,5-7,12-13H2,1-4H3,(H,25,28)(H,26,29)/t16-/m0/s1 |
| InChIKey | BMVCQNPFNSUHHF-INIZCTEOSA-N |
| XLogP | 4.17 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|