C12H11F13O4 — CID 10742827
(2S,3R,4R,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)oxolane-2,3,4-triol (PubChem CID 10742827) has the molecular formula C12H11F13O4 and a molecular weight of 466.19 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)oxolane-2,3,4-triol.
| Compound Name | (2S,3R,4R,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 10742827 |
| Molecular Formula | C12H11F13O4 |
| Molecular Weight | 466.19 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | (2S,3R,4R,5R)-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)oxolane-2,3,4-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[C@@H]1O |
| InChI | InChI=1S/C12H11F13O4/c13-7(14,2-1-3-4(26)5(27)6(28)29-3)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h3-6,26-28H,1-2H2/t3-,4+,5-,6+/m1/s1 |
| InChIKey | UURGEVDVXSQTJA-MOJAZDJTSA-N |
| XLogP | 2.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.19 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|