C17H17F17O6 — CID 102071900
(3R,4S,5R,6R)-4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-6-(hydroxymethyl)oxane-2,3,5-triol (PubChem CID 102071900) has the molecular formula C17H17F17O6 and a molecular weight of 640.28 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-6-(hydroxymethyl)oxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-6-(hydroxymethyl)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 102071900 |
| Molecular Formula | C17H17F17O6 |
| Molecular Weight | 640.28 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | (3R,4S,5R,6R)-4-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)-6-(hydroxymethyl)oxane-2,3,5-triol |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H](OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C17H17F17O6/c18-10(19,2-1-3-39-8-6(36)5(4-35)40-9(38)7(8)37)11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)34/h5-9,35-38H,1-4H2/t5-,6-,7-,8+,9?/m1/s1 |
| InChIKey | NOGNAXHAXAJNDP-NBTWYFBKSA-N |
| XLogP | 3.59 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|