About 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one
7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one (PubChem CID 107430727) has the molecular formula C18H23FO2
and a molecular weight of 290.38 g/mol. Its IUPAC name is 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one.
Molecular Properties
| Compound Name | 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| PubChem CID | 107430727 |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one |
| SMILES | CC(C)CC1CCCC2(CC(=O)c3ccc(F)cc3O2)C1 |
| InChI | InChI=1S/C18H23FO2/c1-12(2)8-13-4-3-7-18(10-13)11-16(20)15-6-5-14(19)9-17(15)21-18/h5-6,9,12-13H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | SYTZYKHSCWVHNB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The IUPAC name of 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one (CID 107430727) is 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one.
What is the SMILES notation for 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The canonical SMILES for 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one is CC(C)CC1CCCC2(CC(=O)c3ccc(F)cc3O2)C1.
What is the InChIKey of 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
The InChIKey is SYTZYKHSCWVHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FO2/c1-12(2)8-13-4-3-7-18(10-13)11-16(20)15-6-5-14(19)9-17(15)21-18/h5-6,9,12-13H,3-4,7-8,10-11H2,1-2H3.
What are the key properties of 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one?
7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one has a molecular weight of 290.38 g/mol, XLogP of 4.77, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3'-(2-methylpropyl)spiro[3H-chromene-2,1'-cyclohexane]-4-one is sourced from PubChem (CID 107430727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).