C15H14O3S — CID 107432406
2-[(3-cyclopropylphenyl)-hydroxymethyl]thiophene-3-carboxylic acid (PubChem CID 107432406) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-[(3-cyclopropylphenyl)-hydroxymethyl]thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-cyclopropylphenyl)-hydroxymethyl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 107432406 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[(3-cyclopropylphenyl)-hydroxymethyl]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1C(O)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C15H14O3S/c16-13(14-12(15(17)18)6-7-19-14)11-3-1-2-10(8-11)9-4-5-9/h1-3,6-9,13,16H,4-5H2,(H,17,18) |
| InChIKey | MKQAPFOWZABICC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |