C13H19N3O2S — CID 107434506
N-(2-methyl-1-thiophen-2-ylpropyl)-5-oxopiperazine-2-carboxamide (PubChem CID 107434506) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(2-methyl-1-thiophen-2-ylpropyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(2-methyl-1-thiophen-2-ylpropyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107434506 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2-methyl-1-thiophen-2-ylpropyl)-5-oxopiperazine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)C1CNC(=O)CN1)c1cccs1 |
| InChI | InChI=1S/C13H19N3O2S/c1-8(2)12(10-4-3-5-19-10)16-13(18)9-6-15-11(17)7-14-9/h3-5,8-9,12,14H,6-7H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | XEYLXPUTUYTCSP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |