C12H20N4O4 — CID 107435401
methyl 2-[4-(5-oxopiperazine-2-carbonyl)piperazin-1-yl]acetate (PubChem CID 107435401) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 2-[4-(5-oxopiperazine-2-carbonyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-(5-oxopiperazine-2-carbonyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 107435401 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | methyl 2-[4-(5-oxopiperazine-2-carbonyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(C(=O)C2CNC(=O)CN2)CC1 |
| InChI | InChI=1S/C12H20N4O4/c1-20-11(18)8-15-2-4-16(5-3-15)12(19)9-6-14-10(17)7-13-9/h9,13H,2-8H2,1H3,(H,14,17) |
| InChIKey | BAIAUVPLNLHZQW-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |