C14H24N4O3 — CID 107435207
2-methyl-N-[1-(5-oxopiperazine-2-carbonyl)piperidin-4-yl]propanamide (PubChem CID 107435207) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-methyl-N-[1-(5-oxopiperazine-2-carbonyl)piperidin-4-yl]propanamide.
| Compound Name | 2-methyl-N-[1-(5-oxopiperazine-2-carbonyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 107435207 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-methyl-N-[1-(5-oxopiperazine-2-carbonyl)piperidin-4-yl]propanamide |
| SMILES | CC(C)C(=O)NC1CCN(C(=O)C2CNC(=O)CN2)CC1 |
| InChI | InChI=1S/C14H24N4O3/c1-9(2)13(20)17-10-3-5-18(6-4-10)14(21)11-7-16-12(19)8-15-11/h9-11,15H,3-8H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | JTOFUWCRXFIAHP-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |