C10H15N3O2 — CID 107437768
5-(3,6-dihydro-2H-pyridine-1-carbonyl)piperazin-2-one (PubChem CID 107437768) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 5-(3,6-dihydro-2H-pyridine-1-carbonyl)piperazin-2-one.
| Compound Name | 5-(3,6-dihydro-2H-pyridine-1-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 107437768 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 5-(3,6-dihydro-2H-pyridine-1-carbonyl)piperazin-2-one |
| SMILES | O=C1CNC(C(=O)N2CC=CCC2)CN1 |
| InChI | InChI=1S/C10H15N3O2/c14-9-7-11-8(6-12-9)10(15)13-4-2-1-3-5-13/h1-2,8,11H,3-7H2,(H,12,14) |
| InChIKey | UCTSEFDLDAARRY-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|