C14H23N3O4 — CID 107437161
3-[1-(5-oxopiperazine-2-carbonyl)piperidin-3-yl]butanoic acid (PubChem CID 107437161) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-[1-(5-oxopiperazine-2-carbonyl)piperidin-3-yl]butanoic acid.
| Compound Name | 3-[1-(5-oxopiperazine-2-carbonyl)piperidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 107437161 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[1-(5-oxopiperazine-2-carbonyl)piperidin-3-yl]butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCN(C(=O)C2CNC(=O)CN2)C1 |
| InChI | InChI=1S/C14H23N3O4/c1-9(5-13(19)20)10-3-2-4-17(8-10)14(21)11-6-16-12(18)7-15-11/h9-11,15H,2-8H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | MHVNXHJVDRHZQO-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |