C12H11ClN4O2 — CID 107435991
5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one (PubChem CID 107435991) has the molecular formula C12H11ClN4O2 and a molecular weight of 278.70 g/mol. Its IUPAC name is 5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one.
| Compound Name | 5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
|---|---|
| PubChem CID | 107435991 |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.70 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]piperazin-2-one |
| SMILES | O=C1CNC(c2nc(-c3cccc(Cl)c3)no2)CN1 |
| InChI | InChI=1S/C12H11ClN4O2/c13-8-3-1-2-7(4-8)11-16-12(19-17-11)9-5-15-10(18)6-14-9/h1-4,9,14H,5-6H2,(H,15,18) |
| InChIKey | GWAKQDKNWGYYNN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |