C22H29N3O6SSi — CID 10743710
ethyl N-[4-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate (PubChem CID 10743710) has the molecular formula C22H29N3O6SSi and a molecular weight of 491.64 g/mol. Its IUPAC name is ethyl N-[4-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 10743710 |
| Molecular Formula | C22H29N3O6SSi |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | ethyl N-[4-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)N2Cc3ccccc3C[C@@H]2C(=O)NO[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O6SSi/c1-5-30-22(27)23-18-10-12-19(13-11-18)32(28,29)25-15-17-9-7-6-8-16(17)14-20(25)21(26)24-31-33(2,3)4/h6-13,20H,5,14-15H2,1-4H3,(H,23,27)(H,24,26)/t20-/m1/s1 |
| InChIKey | JWIMPQWZMWKFJA-HXUWFJFHSA-N |
| XLogP | 3.25 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|