C27H31N3O7SSi — CID 10745633
(4-methoxyphenyl) N-[3-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate (PubChem CID 10745633) has the molecular formula C27H31N3O7SSi and a molecular weight of 569.71 g/mol. Its IUPAC name is (4-methoxyphenyl) N-[3-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate.
| Compound Name | (4-methoxyphenyl) N-[3-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 10745633 |
| Molecular Formula | C27H31N3O7SSi |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | (4-methoxyphenyl) N-[3-[[(3R)-3-(trimethylsilyloxycarbamoyl)-3,4-dihydro-1H-isoquinolin-2-yl]sulfonyl]phenyl]carbamate |
| SMILES | COc1ccc(OC(=O)Nc2cccc(S(=O)(=O)N3Cc4ccccc4C[C@@H]3C(=O)NO[Si](C)(C)C)c2)cc1 |
| InChI | InChI=1S/C27H31N3O7SSi/c1-35-22-12-14-23(15-13-22)36-27(32)28-21-10-7-11-24(17-21)38(33,34)30-18-20-9-6-5-8-19(20)16-25(30)26(31)29-37-39(2,3)4/h5-15,17,25H,16,18H2,1-4H3,(H,28,32)(H,29,31)/t25-/m1/s1 |
| InChIKey | WYGOQZFBXHYZBO-RUZDIDTESA-N |
| XLogP | 4.30 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|