C11H18N4O4 — CID 107437216
1-(4-methylpiperazine-1-carbonyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107437216) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 1-(4-methylpiperazine-1-carbonyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(4-methylpiperazine-1-carbonyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107437216 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-(4-methylpiperazine-1-carbonyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | CN1CCN(C(=O)N2CC(=O)NCC2C(=O)O)CC1 |
| InChI | InChI=1S/C11H18N4O4/c1-13-2-4-14(5-3-13)11(19)15-7-9(16)12-6-8(15)10(17)18/h8H,2-7H2,1H3,(H,12,16)(H,17,18) |
| InChIKey | REXDSMFKUNTGHW-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |