C11H17N3O4 — CID 107432800
1-(1-methylpyrrolidine-3-carbonyl)-5-oxopiperazine-2-carboxylic acid (PubChem CID 107432800) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-(1-methylpyrrolidine-3-carbonyl)-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-(1-methylpyrrolidine-3-carbonyl)-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107432800 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 1-(1-methylpyrrolidine-3-carbonyl)-5-oxopiperazine-2-carboxylic acid |
| SMILES | CN1CCC(C(=O)N2CC(=O)NCC2C(=O)O)C1 |
| InChI | InChI=1S/C11H17N3O4/c1-13-3-2-7(5-13)10(16)14-6-9(15)12-4-8(14)11(17)18/h7-8H,2-6H2,1H3,(H,12,15)(H,17,18) |
| InChIKey | HLTGIEGWHFMHJE-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |