C13H22N4O4 — CID 107438078
1-[(1-ethylpyrrolidin-3-yl)methylcarbamoyl]-5-oxopiperazine-2-carboxylic acid (PubChem CID 107438078) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-3-yl)methylcarbamoyl]-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-[(1-ethylpyrrolidin-3-yl)methylcarbamoyl]-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107438078 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-3-yl)methylcarbamoyl]-5-oxopiperazine-2-carboxylic acid |
| SMILES | CCN1CCC(CNC(=O)N2CC(=O)NCC2C(=O)O)C1 |
| InChI | InChI=1S/C13H22N4O4/c1-2-16-4-3-9(7-16)5-15-13(21)17-8-11(18)14-6-10(17)12(19)20/h9-10H,2-8H2,1H3,(H,14,18)(H,15,21)(H,19,20) |
| InChIKey | ALHPWWJBIXJYLU-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |