C12H18N4O5 — CID 107439289
1-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid (PubChem CID 107439289) has the molecular formula C12H18N4O5 and a molecular weight of 298.30 g/mol. Its IUPAC name is 1-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107439289 |
| Molecular Formula | C12H18N4O5 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)NCCNC(=O)C2CC2)C(C(=O)O)CN1 |
| InChI | InChI=1S/C12H18N4O5/c17-9-6-16(8(5-15-9)11(19)20)12(21)14-4-3-13-10(18)7-1-2-7/h7-8H,1-6H2,(H,13,18)(H,14,21)(H,15,17)(H,19,20) |
| InChIKey | XLWKMAHLKBITRZ-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|