C10H18N4O4 — CID 107437245
1-[2-(dimethylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid (PubChem CID 107437245) has the molecular formula C10H18N4O4 and a molecular weight of 258.28 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid.
| Compound Name | 1-[2-(dimethylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107437245 |
| Molecular Formula | C10H18N4O4 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 1-[2-(dimethylamino)ethylcarbamoyl]-5-oxopiperazine-2-carboxylic acid |
| SMILES | CN(C)CCNC(=O)N1CC(=O)NCC1C(=O)O |
| InChI | InChI=1S/C10H18N4O4/c1-13(2)4-3-11-10(18)14-6-8(15)12-5-7(14)9(16)17/h7H,3-6H2,1-2H3,(H,11,18)(H,12,15)(H,16,17) |
| InChIKey | WCNHWXHETPUVNO-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |