C11H16F3N3O4 — CID 107439094
5-oxo-1-(5,5,5-trifluoropentylcarbamoyl)piperazine-2-carboxylic acid (PubChem CID 107439094) has the molecular formula C11H16F3N3O4 and a molecular weight of 311.26 g/mol. Its IUPAC name is 5-oxo-1-(5,5,5-trifluoropentylcarbamoyl)piperazine-2-carboxylic acid.
| Compound Name | 5-oxo-1-(5,5,5-trifluoropentylcarbamoyl)piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 107439094 |
| Molecular Formula | C11H16F3N3O4 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 5-oxo-1-(5,5,5-trifluoropentylcarbamoyl)piperazine-2-carboxylic acid |
| SMILES | O=C1CN(C(=O)NCCCCC(F)(F)F)C(C(=O)O)CN1 |
| InChI | InChI=1S/C11H16F3N3O4/c12-11(13,14)3-1-2-4-15-10(21)17-6-8(18)16-5-7(17)9(19)20/h7H,1-6H2,(H,15,21)(H,16,18)(H,19,20) |
| InChIKey | RDUYAOMULZZKMQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|