C30H58Si3 — CID 10744066
[(Z)-1-[(1Z,3E)-2,4-bis(triethylsilyl)buta-1,3-dienyl]oct-1-en-3-ynyl]-triethylsilane (PubChem CID 10744066) has the molecular formula C30H58Si3 and a molecular weight of 503.05 g/mol. Its IUPAC name is [(Z)-1-[(1Z,3E)-2,4-bis(triethylsilyl)buta-1,3-dienyl]oct-1-en-3-ynyl]-triethylsilane.
| Compound Name | [(Z)-1-[(1Z,3E)-2,4-bis(triethylsilyl)buta-1,3-dienyl]oct-1-en-3-ynyl]-triethylsilane |
|---|---|
| PubChem CID | 10744066 |
| Molecular Formula | C30H58Si3 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.38 |
| IUPAC Name | [(Z)-1-[(1Z,3E)-2,4-bis(triethylsilyl)buta-1,3-dienyl]oct-1-en-3-ynyl]-triethylsilane |
| SMILES | CCCCC#C/C=C(/C=C(/C=C/[Si](CC)(CC)CC)[Si](CC)(CC)CC)[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H58Si3/c1-11-21-22-23-24-25-29(32(15-5,16-6)17-7)28-30(33(18-8,19-9)20-10)26-27-31(12-2,13-3)14-4/h25-28H,11-22H2,1-10H3/b27-26+,29-25-,30-28- |
| InChIKey | MKBUHVORIHTKBF-VAVCICCBSA-N |
| XLogP | 10.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|