C16H28N2O3 — CID 107444427
tert-butyl N-tert-butyl-N-[2-(furan-2-ylmethylamino)ethyl]carbamate (PubChem CID 107444427) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[2-(furan-2-ylmethylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[2-(furan-2-ylmethylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 107444427 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[2-(furan-2-ylmethylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNCc1ccco1)C(C)(C)C |
| InChI | InChI=1S/C16H28N2O3/c1-15(2,3)18(14(19)21-16(4,5)6)10-9-17-12-13-8-7-11-20-13/h7-8,11,17H,9-10,12H2,1-6H3 |
| InChIKey | LCIBILBYDRRWBS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|