C13H28N2 — CID 107445909
N'-tert-butyl-N-[(1S)-1-cyclopentylethyl]ethane-1,2-diamine (PubChem CID 107445909) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N'-tert-butyl-N-[(1S)-1-cyclopentylethyl]ethane-1,2-diamine.
| Compound Name | N'-tert-butyl-N-[(1S)-1-cyclopentylethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107445909 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N'-tert-butyl-N-[(1S)-1-cyclopentylethyl]ethane-1,2-diamine |
| SMILES | C[C@H](NCCNC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C13H28N2/c1-11(12-7-5-6-8-12)14-9-10-15-13(2,3)4/h11-12,14-15H,5-10H2,1-4H3/t11-/m0/s1 |
| InChIKey | RRQJGMPLALSEON-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|