C30H43NO5Si — CID 10744660
[(E,2R)-7-[tert-butyl(diphenyl)silyl]oxyhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 10744660) has the molecular formula C30H43NO5Si and a molecular weight of 525.76 g/mol. Its IUPAC name is [(E,2R)-7-[tert-butyl(diphenyl)silyl]oxyhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(E,2R)-7-[tert-butyl(diphenyl)silyl]oxyhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 10744660 |
| Molecular Formula | C30H43NO5Si |
| Molecular Weight | 525.76 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | [(E,2R)-7-[tert-butyl(diphenyl)silyl]oxyhept-3-en-2-yl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | C[C@H](/C=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H43NO5Si/c1-24(35-27(32)23-31-28(33)36-29(2,3)4)17-11-10-16-22-34-37(30(5,6)7,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h8-9,11-15,17-21,24H,10,16,22-23H2,1-7H3,(H,31,33)/b17-11+/t24-/m1/s1 |
| InChIKey | WTRPCXGFNISLMU-PMILPSSXSA-N |
| XLogP | 5.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|