C29H38F3NO4Si — CID 11577563
tert-butyl (E,2R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate (PubChem CID 11577563) has the molecular formula C29H38F3NO4Si and a molecular weight of 549.71 g/mol. Its IUPAC name is tert-butyl (E,2R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate.
| Compound Name | tert-butyl (E,2R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate |
|---|---|
| PubChem CID | 11577563 |
| Molecular Formula | C29H38F3NO4Si |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | tert-butyl (E,2R,6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoate |
| SMILES | C[C@@H](/C=C/C[C@@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H38F3NO4Si/c1-21(15-14-20-24(25(34)36-27(2,3)4)33-26(35)29(30,31)32)37-38(28(5,6)7,22-16-10-8-11-17-22)23-18-12-9-13-19-23/h8-19,21,24H,20H2,1-7H3,(H,33,35)/b15-14+/t21-,24+/m0/s1 |
| InChIKey | YAOZGRSMNLQIDM-ZZPVFWNSSA-N |
| XLogP | 5.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|