C16H25N3OS — CID 107453563
N-(4-aminophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanamide (PubChem CID 107453563) has the molecular formula C16H25N3OS and a molecular weight of 307.46 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanamide.
| Compound Name | N-(4-aminophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanamide |
|---|---|
| PubChem CID | 107453563 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-(4-aminophenyl)-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(N)cc1)N1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C16H25N3OS/c1-12(19-9-8-16(2,3)21-11-10-19)15(20)18-14-6-4-13(17)5-7-14/h4-7,12H,8-11,17H2,1-3H3,(H,18,20) |
| InChIKey | HCPZQTKXAQXUKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|