C15H22FN3O2 — CID 81098789
N-(3-amino-4-fluorophenyl)-2-(4-hydroxy-4-methylpiperidin-1-yl)propanamide (PubChem CID 81098789) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-2-(4-hydroxy-4-methylpiperidin-1-yl)propanamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-2-(4-hydroxy-4-methylpiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 81098789 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-2-(4-hydroxy-4-methylpiperidin-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(F)c(N)c1)N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C15H22FN3O2/c1-10(19-7-5-15(2,21)6-8-19)14(20)18-11-3-4-12(16)13(17)9-11/h3-4,9-10,21H,5-8,17H2,1-2H3,(H,18,20) |
| InChIKey | MUHPHXFHBFZCCE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|