C26H42O6Sn — CID 10745580
(2R,4aR,6S,7S,8R,8aS)-6-pent-4-enoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol;dibutyltin (PubChem CID 10745580) has the molecular formula C26H42O6Sn and a molecular weight of 569.33 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aS)-6-pent-4-enoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol;dibutyltin.
| Compound Name | (2R,4aR,6S,7S,8R,8aS)-6-pent-4-enoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol;dibutyltin |
|---|---|
| PubChem CID | 10745580 |
| Molecular Formula | C26H42O6Sn |
| Molecular Weight | 569.33 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aS)-6-pent-4-enoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol;dibutyltin |
| SMILES | C=CCCCO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@H](O)[C@@H]1O.CCCC[Sn]CCCC |
| InChI | InChI=1S/C18H24O6.2C4H9.Sn/c1-2-3-7-10-21-18-15(20)14(19)16-13(23-18)11-22-17(24-16)12-8-5-4-6-9-12;2*1-3-4-2;/h2,4-6,8-9,13-20H,1,3,7,10-11H2;2*1,3-4H2,2H3;/t13-,14-,15+,16-,17-,18+;;;/m1.../s1 |
| InChIKey | YTPNIEXTTNTNEF-YGYMIYEJSA-N |
| XLogP | 4.66 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|