C14H16FN5O — CID 107458485
3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-4-fluorobenzohydrazide (PubChem CID 107458485) has the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. Its IUPAC name is 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-4-fluorobenzohydrazide.
| Compound Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 107458485 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)-4-fluorobenzohydrazide |
| SMILES | NNC(=O)c1ccc(F)c(CN2CCn3ccnc3C2)c1 |
| InChI | InChI=1S/C14H16FN5O/c15-12-2-1-10(14(21)18-16)7-11(12)8-19-5-6-20-4-3-17-13(20)9-19/h1-4,7H,5-6,8-9,16H2,(H,18,21) |
| InChIKey | KSDMIAVYSGHUQE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|