About (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone
(2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone (PubChem CID 107459013) has the molecular formula C16H25N3OS
and a molecular weight of 307.46 g/mol. Its IUPAC name is (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone.
Molecular Properties
| Compound Name | (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone |
| PubChem CID | 107459013 |
| Molecular Formula | C16H25N3OS |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone |
| SMILES | CCCc1cc(C(=O)N2CCSC(C)(C)CC2)cc(N)n1 |
| InChI | InChI=1S/C16H25N3OS/c1-4-5-13-10-12(11-14(17)18-13)15(20)19-7-6-16(2,3)21-9-8-19/h10-11H,4-9H2,1-3H3,(H2,17,18) |
| InChIKey | XICXNVWSSVTJDZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone?
The IUPAC name of (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone (CID 107459013) is (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone.
What is the SMILES notation for (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone?
The canonical SMILES for (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone is CCCc1cc(C(=O)N2CCSC(C)(C)CC2)cc(N)n1.
What is the InChIKey of (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone?
The InChIKey is XICXNVWSSVTJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3OS/c1-4-5-13-10-12(11-14(17)18-13)15(20)19-7-6-16(2,3)21-9-8-19/h10-11H,4-9H2,1-3H3,(H2,17,18).
What are the key properties of (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone?
(2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone has a molecular weight of 307.46 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-6-propyl-4-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone is sourced from PubChem (CID 107459013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).