C14H11FN4O2 — CID 107461284
2-[1-[(5-fluoroquinolin-8-yl)methyl]triazol-4-yl]acetic acid (PubChem CID 107461284) has the molecular formula C14H11FN4O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 2-[1-[(5-fluoroquinolin-8-yl)methyl]triazol-4-yl]acetic acid.
| Compound Name | 2-[1-[(5-fluoroquinolin-8-yl)methyl]triazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 107461284 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[1-[(5-fluoroquinolin-8-yl)methyl]triazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(Cc2ccc(F)c3cccnc23)nn1 |
| InChI | InChI=1S/C14H11FN4O2/c15-12-4-3-9(14-11(12)2-1-5-16-14)7-19-8-10(17-18-19)6-13(20)21/h1-5,8H,6-7H2,(H,20,21) |
| InChIKey | OAKJZYJPAGNKDF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |