C12H8FN5O2 — CID 47058562
5-fluoro-8-[(3-nitro-1,2,4-triazol-1-yl)methyl]quinoline (PubChem CID 47058562) has the molecular formula C12H8FN5O2 and a molecular weight of 273.23 g/mol. Its IUPAC name is 5-fluoro-8-[(3-nitro-1,2,4-triazol-1-yl)methyl]quinoline.
| Compound Name | 5-fluoro-8-[(3-nitro-1,2,4-triazol-1-yl)methyl]quinoline |
|---|---|
| PubChem CID | 47058562 |
| Molecular Formula | C12H8FN5O2 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-fluoro-8-[(3-nitro-1,2,4-triazol-1-yl)methyl]quinoline |
| SMILES | O=[N+]([O-])c1ncn(Cc2ccc(F)c3cccnc23)n1 |
| InChI | InChI=1S/C12H8FN5O2/c13-10-4-3-8(11-9(10)2-1-5-14-11)6-17-7-15-12(16-17)18(19)20/h1-5,7H,6H2 |
| InChIKey | YWHOFHLNWYCWLH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|