C38H44O5S2 — CID 10746758
(3S,4S,5R)-6,6-bis(ethylsulfanyl)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one (PubChem CID 10746758) has the molecular formula C38H44O5S2 and a molecular weight of 644.90 g/mol. Its IUPAC name is (3S,4S,5R)-6,6-bis(ethylsulfanyl)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one.
| Compound Name | (3S,4S,5R)-6,6-bis(ethylsulfanyl)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one |
|---|---|
| PubChem CID | 10746758 |
| Molecular Formula | C38H44O5S2 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | (3S,4S,5R)-6,6-bis(ethylsulfanyl)-1,3,4,5-tetrakis(phenylmethoxy)hexan-2-one |
| SMILES | CCSC(SCC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)C(=O)COCc1ccccc1 |
| InChI | InChI=1S/C38H44O5S2/c1-3-44-38(45-4-2)37(43-28-33-23-15-8-16-24-33)36(42-27-32-21-13-7-14-22-32)35(41-26-31-19-11-6-12-20-31)34(39)29-40-25-30-17-9-5-10-18-30/h5-24,35-38H,3-4,25-29H2,1-2H3/t35-,36+,37-/m1/s1 |
| InChIKey | PXYNOZVVZSMGCY-HPJTWKJOSA-N |
| XLogP | 8.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|